C25H32FN3O4S — CID 17223755
N-[4-(dipropylsulfamoyl)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 17223755) has the molecular formula C25H32FN3O4S and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[4-(dipropylsulfamoyl)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(dipropylsulfamoyl)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223755 |
| Molecular Formula | C25H32FN3O4S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[4-(dipropylsulfamoyl)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C25H32FN3O4S/c1-3-14-29(15-4-2)34(32,33)23-10-8-22(9-11-23)27-24(30)19-12-16-28(17-13-19)25(31)20-6-5-7-21(26)18-20/h5-11,18-19H,3-4,12-17H2,1-2H3,(H,27,30) |
| InChIKey | SUBKUCOOJIFMJM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |