C23H28FN3O2 — CID 113008104
N-[4-(diethylamino)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 113008104) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113008104 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H28FN3O2/c1-3-26(4-2)21-10-8-20(9-11-21)25-22(28)17-12-14-27(15-13-17)23(29)18-6-5-7-19(24)16-18/h5-11,16-17H,3-4,12-15H2,1-2H3,(H,25,28) |
| InChIKey | UOBIXBLLVYYVNK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|