C27H36FN3O4S — CID 17223813
N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 17223813) has the molecular formula C27H36FN3O4S and a molecular weight of 517.67 g/mol. Its IUPAC name is N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223813 |
| Molecular Formula | C27H36FN3O4S |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[4-[bis(2-methylpropyl)sulfamoyl]phenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H36FN3O4S/c1-19(2)17-31(18-20(3)4)36(34,35)25-10-8-24(9-11-25)29-26(32)21-12-14-30(15-13-21)27(33)22-6-5-7-23(28)16-22/h5-11,16,19-21H,12-15,17-18H2,1-4H3,(H,29,32) |
| InChIKey | PBTLDKGCVMEQQR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |