C23H26N4O5S — CID 31589377
1-[3-(cyclopropanecarbonylamino)benzoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 31589377) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 1-[3-(cyclopropanecarbonylamino)benzoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(cyclopropanecarbonylamino)benzoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31589377 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 1-[3-(cyclopropanecarbonylamino)benzoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)c3cccc(NC(=O)C4CC4)c3)CC2)cc1 |
| InChI | InChI=1S/C23H26N4O5S/c24-33(31,32)20-8-6-18(7-9-20)25-22(29)16-10-12-27(13-11-16)23(30)17-2-1-3-19(14-17)26-21(28)15-4-5-15/h1-3,6-9,14-16H,4-5,10-13H2,(H,25,29)(H,26,28)(H2,24,31,32) |
| InChIKey | RNCZAXVRXWGOMX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |