C21H22BrN3O4S — CID 26454870
1-[(E)-3-(3-bromophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 26454870) has the molecular formula C21H22BrN3O4S and a molecular weight of 492.40 g/mol. Its IUPAC name is 1-[(E)-3-(3-bromophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-(3-bromophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26454870 |
| Molecular Formula | C21H22BrN3O4S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 1-[(E)-3-(3-bromophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)/C=C/c3cccc(Br)c3)CC2)cc1 |
| InChI | InChI=1S/C21H22BrN3O4S/c22-17-3-1-2-15(14-17)4-9-20(26)25-12-10-16(11-13-25)21(27)24-18-5-7-19(8-6-18)30(23,28)29/h1-9,14,16H,10-13H2,(H,24,27)(H2,23,28,29)/b9-4+ |
| InChIKey | VWIHJJCBADKXTB-RUDMXATFSA-N |
| XLogP | 2.99 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|