C21H21Cl2N3O4S — CID 26454873
1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 26454873) has the molecular formula C21H21Cl2N3O4S and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26454873 |
| Molecular Formula | C21H21Cl2N3O4S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O4S/c22-18-7-1-14(13-19(18)23)2-8-20(27)26-11-9-15(10-12-26)21(28)25-16-3-5-17(6-4-16)31(24,29)30/h1-8,13,15H,9-12H2,(H,25,28)(H2,24,29,30)/b8-2+ |
| InChIKey | IGAAWBPAKDOKRP-KRXBUXKQSA-N |
| XLogP | 3.53 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|