C22H24ClN3O2 — CID 55992545
1-[3-(3-chloro-4-methylphenyl)prop-2-enoyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55992545) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-methylphenyl)prop-2-enoyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(3-chloro-4-methylphenyl)prop-2-enoyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55992545 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[3-(3-chloro-4-methylphenyl)prop-2-enoyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(C(=O)C=Cc3ccc(C)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-15-7-10-24-20(13-15)25-22(28)18-8-11-26(12-9-18)21(27)6-5-17-4-3-16(2)19(23)14-17/h3-7,10,13-14,18H,8-9,11-12H2,1-2H3,(H,24,25,28) |
| InChIKey | ZCYAIYPQWMBESV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|