C21H23F2N3O3 — CID 55931889
1-[2-[4-(difluoromethoxy)phenyl]acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55931889) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55931889 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(C(=O)Cc3ccc(OC(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H23F2N3O3/c1-14-6-9-24-18(12-14)25-20(28)16-7-10-26(11-8-16)19(27)13-15-2-4-17(5-3-15)29-21(22)23/h2-6,9,12,16,21H,7-8,10-11,13H2,1H3,(H,24,25,28) |
| InChIKey | MENTZMYLULPBKM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |