C20H21BrFN3O3 — CID 55813073
1-[2-(4-bromo-2-fluorophenoxy)acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55813073) has the molecular formula C20H21BrFN3O3 and a molecular weight of 450.31 g/mol. Its IUPAC name is 1-[2-(4-bromo-2-fluorophenoxy)acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-bromo-2-fluorophenoxy)acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55813073 |
| Molecular Formula | C20H21BrFN3O3 |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 1-[2-(4-bromo-2-fluorophenoxy)acetyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(C(=O)COc3ccc(Br)cc3F)CC2)c1 |
| InChI | InChI=1S/C20H21BrFN3O3/c1-13-4-7-23-18(10-13)24-20(27)14-5-8-25(9-6-14)19(26)12-28-17-3-2-15(21)11-16(17)22/h2-4,7,10-11,14H,5-6,8-9,12H2,1H3,(H,23,24,27) |
| InChIKey | KIEKOLQAXIHNKK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |