C24H30FN3O5S — CID 17223739
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 17223739) has the molecular formula C24H30FN3O5S and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223739 |
| Molecular Formula | C24H30FN3O5S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-1-(3-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)C2CCN(C(=O)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C24H30FN3O5S/c1-4-28(5-2)34(31,32)20-9-10-22(33-3)21(16-20)26-23(29)17-11-13-27(14-12-17)24(30)18-7-6-8-19(25)15-18/h6-10,15-17H,4-5,11-14H2,1-3H3,(H,26,29) |
| InChIKey | PSOXLSYPKGKYMQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |