C19H30N2O3S — CID 1213799
N-[4-(dipropylsulfamoyl)phenyl]cyclohexanecarboxamide (PubChem CID 1213799) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[4-(dipropylsulfamoyl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(dipropylsulfamoyl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 1213799 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[4-(dipropylsulfamoyl)phenyl]cyclohexanecarboxamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H30N2O3S/c1-3-14-21(15-4-2)25(23,24)18-12-10-17(11-13-18)20-19(22)16-8-6-5-7-9-16/h10-13,16H,3-9,14-15H2,1-2H3,(H,20,22) |
| InChIKey | VAWFQBIPGUQSHR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |