C23H38N2O3S — CID 3715174
3-cyclohexyl-N-[4-(dibutylsulfamoyl)phenyl]propanamide (PubChem CID 3715174) has the molecular formula C23H38N2O3S and a molecular weight of 422.64 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-(dibutylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[4-(dibutylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 3715174 |
| Molecular Formula | C23H38N2O3S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 3-cyclohexyl-N-[4-(dibutylsulfamoyl)phenyl]propanamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(NC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H38N2O3S/c1-3-5-18-25(19-6-4-2)29(27,28)22-15-13-21(14-16-22)24-23(26)17-12-20-10-8-7-9-11-20/h13-16,20H,3-12,17-19H2,1-2H3,(H,24,26) |
| InChIKey | CTRFOZPCPYFHIW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |