C19H30N2O4S — CID 5031253
3-cyclohexyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]propanamide (PubChem CID 5031253) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 5031253 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-cyclohexyl-N-[4-(3-methoxypropylsulfamoyl)phenyl]propanamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(NC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H30N2O4S/c1-25-15-5-14-20-26(23,24)18-11-9-17(10-12-18)21-19(22)13-8-16-6-3-2-4-7-16/h9-12,16,20H,2-8,13-15H2,1H3,(H,21,22) |
| InChIKey | BIMYRNODEFWGBM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|