C14H19NO4S — CID 82165049
4-(cyclopropanecarbonyl)-N-(3-methoxypropyl)benzenesulfonamide (PubChem CID 82165049) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-(cyclopropanecarbonyl)-N-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | 4-(cyclopropanecarbonyl)-N-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82165049 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-(cyclopropanecarbonyl)-N-(3-methoxypropyl)benzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-19-10-2-9-15-20(17,18)13-7-5-12(6-8-13)14(16)11-3-4-11/h5-8,11,15H,2-4,9-10H2,1H3 |
| InChIKey | HONJOTDQVSTCQN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|