C13H21NO6S2 — CID 55559817
N-[3-(2-methoxyethoxy)propyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 55559817) has the molecular formula C13H21NO6S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55559817 |
| Molecular Formula | C13H21NO6S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | COCCOCCCNS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO6S2/c1-19-10-11-20-9-3-8-14-22(17,18)13-6-4-12(5-7-13)21(2,15)16/h4-7,14H,3,8-11H2,1-2H3 |
| InChIKey | YXIIUFXQUSQBIE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|