C10H19N3O4S — CID 115599999
N-[4-(2-methoxyethoxy)butyl]-1H-pyrazole-4-sulfonamide (PubChem CID 115599999) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)butyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[4-(2-methoxyethoxy)butyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115599999 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[4-(2-methoxyethoxy)butyl]-1H-pyrazole-4-sulfonamide |
| SMILES | COCCOCCCCNS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H19N3O4S/c1-16-6-7-17-5-3-2-4-13-18(14,15)10-8-11-12-9-10/h8-9,13H,2-7H2,1H3,(H,11,12) |
| InChIKey | BHTHOOSNKZNSGW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|