C12H24N4O4S — CID 106001877
1-(3-aminopropyl)-N-[3-(2-methoxyethoxy)propyl]pyrazole-4-sulfonamide (PubChem CID 106001877) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(3-aminopropyl)-N-[3-(2-methoxyethoxy)propyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(3-aminopropyl)-N-[3-(2-methoxyethoxy)propyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106001877 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-(3-aminopropyl)-N-[3-(2-methoxyethoxy)propyl]pyrazole-4-sulfonamide |
| SMILES | COCCOCCCNS(=O)(=O)c1cnn(CCCN)c1 |
| InChI | InChI=1S/C12H24N4O4S/c1-19-8-9-20-7-3-5-15-21(17,18)12-10-14-16(11-12)6-2-4-13/h10-11,15H,2-9,13H2,1H3 |
| InChIKey | CTRZDSNSFTXKIY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|