C11H23N5O3S — CID 106056409
1-(2-aminoethyl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrazole-4-sulfonamide (PubChem CID 106056409) has the molecular formula C11H23N5O3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106056409 |
| Molecular Formula | C11H23N5O3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-(2-aminoethyl)-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyrazole-4-sulfonamide |
| SMILES | COCCN(C)CCNS(=O)(=O)c1cnn(CCN)c1 |
| InChI | InChI=1S/C11H23N5O3S/c1-15(7-8-19-2)6-4-14-20(17,18)11-9-13-16(10-11)5-3-12/h9-10,14H,3-8,12H2,1-2H3 |
| InChIKey | UCGMAUWPVACWSN-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |