C7H15N5O2S — CID 106074651
1-(2-aminoethyl)-N',N'-dimethylpyrazole-4-sulfonohydrazide (PubChem CID 106074651) has the molecular formula C7H15N5O2S and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N',N'-dimethylpyrazole-4-sulfonohydrazide.
| Compound Name | 1-(2-aminoethyl)-N',N'-dimethylpyrazole-4-sulfonohydrazide |
|---|---|
| PubChem CID | 106074651 |
| Molecular Formula | C7H15N5O2S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-(2-aminoethyl)-N',N'-dimethylpyrazole-4-sulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cnn(CCN)c1 |
| InChI | InChI=1S/C7H15N5O2S/c1-11(2)10-15(13,14)7-5-9-12(6-7)4-3-8/h5-6,10H,3-4,8H2,1-2H3 |
| InChIKey | KBSHFWIRFQYOTF-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|