C10H20N6O2S — CID 106075440
1-(2-aminoethyl)-N-(4-methylpiperazin-1-yl)pyrazole-4-sulfonamide (PubChem CID 106075440) has the molecular formula C10H20N6O2S and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(4-methylpiperazin-1-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-(4-methylpiperazin-1-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106075440 |
| Molecular Formula | C10H20N6O2S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(2-aminoethyl)-N-(4-methylpiperazin-1-yl)pyrazole-4-sulfonamide |
| SMILES | CN1CCN(NS(=O)(=O)c2cnn(CCN)c2)CC1 |
| InChI | InChI=1S/C10H20N6O2S/c1-14-4-6-15(7-5-14)13-19(17,18)10-8-12-16(9-10)3-2-11/h8-9,13H,2-7,11H2,1H3 |
| InChIKey | QYYWZLRXCMVOAQ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |