C7H12F2N4O2S — CID 115409125
1-(2-aminoethyl)-N-(2,2-difluoroethyl)pyrazole-4-sulfonamide (PubChem CID 115409125) has the molecular formula C7H12F2N4O2S and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(2,2-difluoroethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-(2,2-difluoroethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115409125 |
| Molecular Formula | C7H12F2N4O2S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-(2-aminoethyl)-N-(2,2-difluoroethyl)pyrazole-4-sulfonamide |
| SMILES | NCCn1cc(S(=O)(=O)NCC(F)F)cn1 |
| InChI | InChI=1S/C7H12F2N4O2S/c8-7(9)4-12-16(14,15)6-3-11-13(5-6)2-1-10/h3,5,7,12H,1-2,4,10H2 |
| InChIKey | FIFFMXHKYFOEKW-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |