C11H22N4O2S2 — CID 106093633
1-(2-aminoethyl)-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide (PubChem CID 106093633) has the molecular formula C11H22N4O2S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106093633 |
| Molecular Formula | C11H22N4O2S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(2-aminoethyl)-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide |
| SMILES | CSCCCCCNS(=O)(=O)c1cnn(CCN)c1 |
| InChI | InChI=1S/C11H22N4O2S2/c1-18-8-4-2-3-6-14-19(16,17)11-9-13-15(10-11)7-5-12/h9-10,14H,2-8,12H2,1H3 |
| InChIKey | ZAYQJAYSSIPFNK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|