C11H21N5O3S — CID 62850113
N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 62850113) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62850113 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NCCN(C)CCOC)cn1 |
| InChI | InChI=1S/C11H21N5O3S/c1-12-11-13-8-10(9-14-11)20(17,18)15-4-5-16(2)6-7-19-3/h8-9,15H,4-7H2,1-3H3,(H,12,13,14) |
| InChIKey | CJBQRTRTQBPSGR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |