C13H24N4O3S — CID 62153472
N-(2-methoxyethyl)-2-(methylamino)-N-pentan-3-ylpyrimidine-5-sulfonamide (PubChem CID 62153472) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(methylamino)-N-pentan-3-ylpyrimidine-5-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-2-(methylamino)-N-pentan-3-ylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62153472 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-(methylamino)-N-pentan-3-ylpyrimidine-5-sulfonamide |
| SMILES | CCC(CC)N(CCOC)S(=O)(=O)c1cnc(NC)nc1 |
| InChI | InChI=1S/C13H24N4O3S/c1-5-11(6-2)17(7-8-20-4)21(18,19)12-9-15-13(14-3)16-10-12/h9-11H,5-8H2,1-4H3,(H,14,15,16) |
| InChIKey | KYWDPVXGEFTTJF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |