C12H21N3O5S — CID 60951166
5-[2-methoxyethyl(pentan-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 60951166) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is 5-[2-methoxyethyl(pentan-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[2-methoxyethyl(pentan-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 60951166 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-[2-methoxyethyl(pentan-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | CCC(CC)N(CCOC)S(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C12H21N3O5S/c1-4-9(5-2)15(6-7-20-3)21(18,19)11-10(12(16)17)8-13-14-11/h8-9H,4-7H2,1-3H3,(H,13,14)(H,16,17) |
| InChIKey | IPXOYCLOKUYVDH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |