C12H19FN2O3S — CID 62845055
4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide (PubChem CID 62845055) has the molecular formula C12H19FN2O3S and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62845055 |
| Molecular Formula | C12H19FN2O3S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide |
| SMILES | COCCN(C)CCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H19FN2O3S/c1-15(9-10-18-2)8-7-14-19(16,17)12-5-3-11(13)4-6-12/h3-6,14H,7-10H2,1-2H3 |
| InChIKey | QWNABJIZSLRXET-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |