C11H17Cl2N3O3S — CID 64607272
5,6-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 64607272) has the molecular formula C11H17Cl2N3O3S and a molecular weight of 342.25 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607272 |
| Molecular Formula | C11H17Cl2N3O3S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 5,6-dichloro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | COCCN(C)CCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H17Cl2N3O3S/c1-16(5-6-19-2)4-3-15-20(17,18)9-7-10(12)11(13)14-8-9/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | QEGBRHFUGSPEKU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|