C12H18Cl2N2O3S — CID 64608604
5,6-dichloro-N-[2-(3-methylbutoxy)ethyl]pyridine-3-sulfonamide (PubChem CID 64608604) has the molecular formula C12H18Cl2N2O3S and a molecular weight of 341.26 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(3-methylbutoxy)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-(3-methylbutoxy)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608604 |
| Molecular Formula | C12H18Cl2N2O3S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 5,6-dichloro-N-[2-(3-methylbutoxy)ethyl]pyridine-3-sulfonamide |
| SMILES | CC(C)CCOCCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2O3S/c1-9(2)3-5-19-6-4-16-20(17,18)10-7-11(13)12(14)15-8-10/h7-9,16H,3-6H2,1-2H3 |
| InChIKey | ISRSCRWRJPMGHB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|