C8H10Cl2N4O3S — CID 83110624
2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]ethylurea (PubChem CID 83110624) has the molecular formula C8H10Cl2N4O3S and a molecular weight of 313.17 g/mol. Its IUPAC name is 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]ethylurea.
| Compound Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 83110624 |
| Molecular Formula | C8H10Cl2N4O3S |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]ethylurea |
| SMILES | NC(=O)NCCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H10Cl2N4O3S/c9-6-3-5(4-13-7(6)10)18(16,17)14-2-1-12-8(11)15/h3-4,14H,1-2H2,(H3,11,12,15) |
| InChIKey | UVBXVWNZOQRBGZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|