C9H10Cl2N4O2 — CID 78995207
N-[2-(carbamoylamino)ethyl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 78995207) has the molecular formula C9H10Cl2N4O2 and a molecular weight of 277.11 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 78995207 |
| Molecular Formula | C9H10Cl2N4O2 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N4O2/c10-6-3-5(4-15-7(6)11)8(16)13-1-2-14-9(12)17/h3-4H,1-2H2,(H,13,16)(H3,12,14,17) |
| InChIKey | IFNFEXPYWNIZBH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|