C9H7BrCl2N2O — CID 47439184
N-(2-bromoprop-2-enyl)-5,6-dichloropyridine-3-carboxamide (PubChem CID 47439184) has the molecular formula C9H7BrCl2N2O and a molecular weight of 309.98 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(2-bromoprop-2-enyl)-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 47439184 |
| Molecular Formula | C9H7BrCl2N2O |
| Molecular Weight | 309.98 g/mol |
| Exact Mass | 307.91 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-5,6-dichloropyridine-3-carboxamide |
| SMILES | C=C(Br)CNC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H7BrCl2N2O/c1-5(10)3-14-9(15)6-2-7(11)8(12)13-4-6/h2,4H,1,3H2,(H,14,15) |
| InChIKey | FMQUIAPOBNYUSI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|