C10H12Cl2N2OS — CID 63964074
5,6-dichloro-N-(3-methylsulfanylpropyl)pyridine-3-carboxamide (PubChem CID 63964074) has the molecular formula C10H12Cl2N2OS and a molecular weight of 279.19 g/mol. Its IUPAC name is 5,6-dichloro-N-(3-methylsulfanylpropyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(3-methylsulfanylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63964074 |
| Molecular Formula | C10H12Cl2N2OS |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 5,6-dichloro-N-(3-methylsulfanylpropyl)pyridine-3-carboxamide |
| SMILES | CSCCCNC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2OS/c1-16-4-2-3-13-10(15)7-5-8(11)9(12)14-6-7/h5-6H,2-4H2,1H3,(H,13,15) |
| InChIKey | SHGVJBNWHOIYJU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|