C11H14Cl2N2O2S — CID 113239579
5,6-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-carboxamide (PubChem CID 113239579) has the molecular formula C11H14Cl2N2O2S and a molecular weight of 309.22 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113239579 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5,6-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-carboxamide |
| SMILES | CSCC(C)(O)CNC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2S/c1-11(17,6-18-2)5-15-10(16)7-3-8(12)9(13)14-4-7/h3-4,17H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | ZJRHOZGUOXMSHG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|