C12H14Cl2N2O4S — CID 106244981
3,4-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-nitrobenzamide (PubChem CID 106244981) has the molecular formula C12H14Cl2N2O4S and a molecular weight of 353.23 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 106244981 |
| Molecular Formula | C12H14Cl2N2O4S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 3,4-dichloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-nitrobenzamide |
| SMILES | CSCC(C)(O)CNC(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14Cl2N2O4S/c1-12(18,6-21-2)5-15-11(17)7-3-8(13)10(14)9(4-7)16(19)20/h3-4,18H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | UCJJYUIKSMZMCF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|