C12H12Cl2N2O3 — CID 113463738
3,4-dichloro-N-[(2-methylcyclopropyl)methyl]-5-nitrobenzamide (PubChem CID 113463738) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2-methylcyclopropyl)methyl]-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-[(2-methylcyclopropyl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 113463738 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3,4-dichloro-N-[(2-methylcyclopropyl)methyl]-5-nitrobenzamide |
| SMILES | CC1CC1CNC(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-6-2-8(6)5-15-12(17)7-3-9(13)11(14)10(4-7)16(18)19/h3-4,6,8H,2,5H2,1H3,(H,15,17) |
| InChIKey | HNMGDZSDDRNVAW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|