C11H9Cl2N3O3 — CID 103857578
3,4-dichloro-N-(2-cyanopropan-2-yl)-5-nitrobenzamide (PubChem CID 103857578) has the molecular formula C11H9Cl2N3O3 and a molecular weight of 302.12 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-cyanopropan-2-yl)-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-(2-cyanopropan-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 103857578 |
| Molecular Formula | C11H9Cl2N3O3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 3,4-dichloro-N-(2-cyanopropan-2-yl)-5-nitrobenzamide |
| SMILES | CC(C)(C#N)NC(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9Cl2N3O3/c1-11(2,5-14)15-10(17)6-3-7(12)9(13)8(4-6)16(18)19/h3-4H,1-2H3,(H,15,17) |
| InChIKey | QOALURTVNUZCFP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|