C11H10Cl2N2O5 — CID 60654184
methyl 2-[(3,4-dichloro-5-nitrobenzoyl)amino]propanoate (PubChem CID 60654184) has the molecular formula C11H10Cl2N2O5 and a molecular weight of 321.12 g/mol. Its IUPAC name is methyl 2-[(3,4-dichloro-5-nitrobenzoyl)amino]propanoate.
| Compound Name | methyl 2-[(3,4-dichloro-5-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 60654184 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | methyl 2-[(3,4-dichloro-5-nitrobenzoyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10Cl2N2O5/c1-5(11(17)20-2)14-10(16)6-3-7(12)9(13)8(4-6)15(18)19/h3-5H,1-2H3,(H,14,16) |
| InChIKey | YJEAFKJWCADZTH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|