C11H11N3O7 — CID 14178530
methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]propanoate (PubChem CID 14178530) has the molecular formula C11H11N3O7 and a molecular weight of 297.22 g/mol. Its IUPAC name is methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]propanoate.
| Compound Name | methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 14178530 |
| Molecular Formula | C11H11N3O7 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O7/c1-6(11(16)21-2)12-10(15)7-3-8(13(17)18)5-9(4-7)14(19)20/h3-6H,1-2H3,(H,12,15)/t6-/m1/s1 |
| InChIKey | WBPRUTIZOCGSGB-ZCFIWIBFSA-N |
| XLogP | 0.79 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|