C13H15N3O7 — CID 2305828
methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 2305828) has the molecular formula C13H15N3O7 and a molecular weight of 325.28 g/mol. Its IUPAC name is methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 2305828 |
| Molecular Formula | C13H15N3O7 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | methyl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C13H15N3O7/c1-7(2)11(13(18)23-3)14-12(17)8-4-9(15(19)20)6-10(5-8)16(21)22/h4-7,11H,1-3H3,(H,14,17)/t11-/m1/s1 |
| InChIKey | RHAWIJIMMGELRY-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|