C22H24N4O8 — CID 14122702
methyl (2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate (PubChem CID 14122702) has the molecular formula C22H24N4O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 14122702 |
| Molecular Formula | C22H24N4O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C22H24N4O8/c1-13(2)19(21(28)23-18(22(29)34-3)9-14-7-5-4-6-8-14)24-20(27)15-10-16(25(30)31)12-17(11-15)26(32)33/h4-8,10-13,18-19H,9H2,1-3H3,(H,23,28)(H,24,27)/t18-,19-/m0/s1 |
| InChIKey | PINMCHOSCNJGIL-OALUTQOASA-N |
| XLogP | 2.16 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|