C27H27N3O9S — CID 147483969
methyl (2S)-2-[[(2R)-2-(benzylsulfonylmethyl)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 147483969) has the molecular formula C27H27N3O9S and a molecular weight of 569.59 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-(benzylsulfonylmethyl)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-(benzylsulfonylmethyl)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 147483969 |
| Molecular Formula | C27H27N3O9S |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-(benzylsulfonylmethyl)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)[C@@H](Cc1ccc([N+](=O)[O-])cc1)CS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H27N3O9S/c1-39-27(32)25(16-20-9-13-24(14-10-20)30(35)36)28-26(31)22(15-19-7-11-23(12-8-19)29(33)34)18-40(37,38)17-21-5-3-2-4-6-21/h2-14,22,25H,15-18H2,1H3,(H,28,31)/t22-,25-/m0/s1 |
| InChIKey | FEFBQBBQZGWVLF-DHLKQENFSA-N |
| XLogP | 3.18 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|