C11H14N2O4 — CID 134856926
methyl (2R)-2-(methylamino)-3-(4-nitrophenyl)propanoate (PubChem CID 134856926) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl (2R)-2-(methylamino)-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2R)-2-(methylamino)-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 134856926 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl (2R)-2-(methylamino)-3-(4-nitrophenyl)propanoate |
| SMILES | CN[C@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C11H14N2O4/c1-12-10(11(14)17-2)7-8-3-5-9(6-4-8)13(15)16/h3-6,10,12H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | HZOBYDCBHSDBKW-SNVBAGLBSA-N |
| XLogP | 0.90 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|