About methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate
methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate (PubChem CID 158629845) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate.
Molecular Properties
| Compound Name | methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate |
| PubChem CID | 158629845 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate |
| SMILES | C.COC(=O)[C@@H](C)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO4.CH4/c1-8(11(13)16-2)7-9-3-5-10(6-4-9)12(14)15;/h3-6,8H,7H2,1-2H3;1H4/t8-;/m0./s1 |
| InChIKey | HZAZEYGFRHBMMP-QRPNPIFTSA-N |
| XLogP | 2.58 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate?
The IUPAC name of methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate (CID 158629845) is methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate.
What is the SMILES notation for methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate?
The canonical SMILES for methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate is C.COC(=O)[C@@H](C)Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate?
The InChIKey is HZAZEYGFRHBMMP-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H13NO4.CH4/c1-8(11(13)16-2)7-9-3-5-10(6-4-9)12(14)15;/h3-6,8H,7H2,1-2H3;1H4/t8-;/m0./s1.
What are the key properties of methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate?
methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate has a molecular weight of 239.27 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl (2S)-2-methyl-3-(4-nitrophenyl)propanoate is sourced from PubChem (CID 158629845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).