C21H30N2O8 — CID 91011363
ditert-butyl 2-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]propanedioate (PubChem CID 91011363) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is ditert-butyl 2-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]propanedioate.
| Compound Name | ditert-butyl 2-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]propanedioate |
|---|---|
| PubChem CID | 91011363 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | ditert-butyl 2-[[(2S)-1-methoxy-3-(4-nitrophenyl)-1-oxopropan-2-yl]amino]propanedioate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30N2O8/c1-20(2,3)30-18(25)16(19(26)31-21(4,5)6)22-15(17(24)29-7)12-13-8-10-14(11-9-13)23(27)28/h8-11,15-16,22H,12H2,1-7H3/t15-/m0/s1 |
| InChIKey | JAMAQOWLJCSDEG-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|