C20H22N2O6 — CID 66953158
tert-butyl 2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate (PubChem CID 66953158) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is tert-butyl 2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 66953158 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl 2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1)NC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-20(2,3)28-18(23)17(13-14-7-5-4-6-8-14)21-19(24)27-16-11-9-15(10-12-16)22(25)26/h4-12,17H,13H2,1-3H3,(H,21,24) |
| InChIKey | ZWJFAMDJIZMZPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|