C27H31N3O8 — CID 135134561
tert-butyl 3-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(4-nitrophenoxy)carbonylamino]-3-oxopropyl]indole-1-carboxylate (PubChem CID 135134561) has the molecular formula C27H31N3O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(4-nitrophenoxy)carbonylamino]-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(4-nitrophenoxy)carbonylamino]-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 135134561 |
| Molecular Formula | C27H31N3O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | tert-butyl 3-[(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(4-nitrophenoxy)carbonylamino]-3-oxopropyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)NC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H31N3O8/c1-26(2,3)37-23(31)21(28-24(32)36-19-13-11-18(12-14-19)30(34)35)15-17-16-29(25(33)38-27(4,5)6)22-10-8-7-9-20(17)22/h7-14,16,21H,15H2,1-6H3,(H,28,32)/t21-/m0/s1 |
| InChIKey | VVZPWJJPNHCCIQ-NRFANRHFSA-N |
| XLogP | 5.37 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|