C24H32N2O7 — CID 21032469
tert-butyl 3-[5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,5-dioxopentyl]indole-1-carboxylate (PubChem CID 21032469) has the molecular formula C24H32N2O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is tert-butyl 3-[5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,5-dioxopentyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,5-dioxopentyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 21032469 |
| Molecular Formula | C24H32N2O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | tert-butyl 3-[5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,5-dioxopentyl]indole-1-carboxylate |
| SMILES | COC(=O)C(CC(=O)Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N2O7/c1-23(2,3)32-21(29)25-18(20(28)31-7)13-16(27)12-15-14-26(22(30)33-24(4,5)6)19-11-9-8-10-17(15)19/h8-11,14,18H,12-13H2,1-7H3,(H,25,29) |
| InChIKey | JSILNQZLWLIOTE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|