C21H28N2O5 — CID 88559112
tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate (PubChem CID 88559112) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 88559112 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)Cc1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C21H28N2O5/c1-20(2,3)27-18(25)22-15(13-24)11-14-12-23(19(26)28-21(4,5)6)17-10-8-7-9-16(14)17/h7-10,12-13,15H,11H2,1-6H3,(H,22,25) |
| InChIKey | QWLUESXWTNTYIW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|