C22H33NO4 — CID 142373045
tert-butyl formate;tert-butyl 3-(2-methylpropyl)indole-1-carboxylate (PubChem CID 142373045) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl formate;tert-butyl 3-(2-methylpropyl)indole-1-carboxylate.
| Compound Name | tert-butyl formate;tert-butyl 3-(2-methylpropyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 142373045 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | tert-butyl formate;tert-butyl 3-(2-methylpropyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC=O.CC(C)Cc1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C17H23NO2.C5H10O2/c1-12(2)10-13-11-18(16(19)20-17(3,4)5)15-9-7-6-8-14(13)15;1-5(2,3)7-4-6/h6-9,11-12H,10H2,1-5H3;4H,1-3H3 |
| InChIKey | OTPFAGFGNVDYMK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|