C20H25NO7 — CID 10572537
dimethyl 2-methoxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]propanedioate (PubChem CID 10572537) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is dimethyl 2-methoxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]propanedioate.
| Compound Name | dimethyl 2-methoxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 10572537 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | dimethyl 2-methoxy-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)(OC)C(=O)OC |
| InChI | InChI=1S/C20H25NO7/c1-19(2,3)28-18(24)21-12-13(14-9-7-8-10-15(14)21)11-20(27-6,16(22)25-4)17(23)26-5/h7-10,12H,11H2,1-6H3 |
| InChIKey | XNAIRRAPIAFLIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|